About disodium;dimethylcarbamodithioic acid;hydride
disodium;dimethylcarbamodithioic acid;hydride (PubChem CID 174615347) has the molecular formula C3H9NNa2S2
and a molecular weight of 169.23 g/mol. Its IUPAC name is disodium;dimethylcarbamodithioic acid;hydride.
Molecular Properties
| Compound Name | disodium;dimethylcarbamodithioic acid;hydride |
| PubChem CID | 174615347 |
| Molecular Formula | C3H9NNa2S2 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | disodium;dimethylcarbamodithioic acid;hydride |
| SMILES | CN(C)C(=S)S.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C3H7NS2.2Na.2H/c1-4(2)3(5)6;;;;/h1-2H3,(H,5,6);;;;/q;2*+1;2*-1 |
| InChIKey | NFJXMHCGBQLKKL-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;dimethylcarbamodithioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;dimethylcarbamodithioic acid;hydride?
The IUPAC name of disodium;dimethylcarbamodithioic acid;hydride (CID 174615347) is disodium;dimethylcarbamodithioic acid;hydride.
What is the SMILES notation for disodium;dimethylcarbamodithioic acid;hydride?
The canonical SMILES for disodium;dimethylcarbamodithioic acid;hydride is CN(C)C(=S)S.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;dimethylcarbamodithioic acid;hydride?
The InChIKey is NFJXMHCGBQLKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NS2.2Na.2H/c1-4(2)3(5)6;;;;/h1-2H3,(H,5,6);;;;/q;2*+1;2*-1.
What are the key properties of disodium;dimethylcarbamodithioic acid;hydride?
disodium;dimethylcarbamodithioic acid;hydride has a molecular weight of 169.23 g/mol, XLogP of -5.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;dimethylcarbamodithioic acid;hydride is sourced from PubChem (CID 174615347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).