C10H13ClN4O2 — CID 59018998
(E)-1-N'-(6-chloro-3-pyridinyl)-1-N,1-N,1-N'-trimethyl-2-nitroethene-1,1-diamine (PubChem CID 59018998) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is (E)-1-N'-(6-chloro-3-pyridinyl)-1-N,1-N,1-N'-trimethyl-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N'-(6-chloro-3-pyridinyl)-1-N,1-N,1-N'-trimethyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 59018998 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (E)-1-N'-(6-chloro-3-pyridinyl)-1-N,1-N,1-N'-trimethyl-2-nitroethene-1,1-diamine |
| SMILES | CN(C)/C(=C\[N+](=O)[O-])N(C)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H13ClN4O2/c1-13(2)10(7-15(16)17)14(3)8-4-5-9(11)12-6-8/h4-7H,1-3H3/b10-7+ |
| InChIKey | DBRIBJFYJWUXSY-JXMROGBWSA-N |
| XLogP | 1.81 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|