C8H10N4O2 — CID 174278087
1-N'-methyl-2-nitro-1-N'-pyridin-3-ylethene-1,1-diamine (PubChem CID 174278087) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-N'-methyl-2-nitro-1-N'-pyridin-3-ylethene-1,1-diamine.
| Compound Name | 1-N'-methyl-2-nitro-1-N'-pyridin-3-ylethene-1,1-diamine |
|---|---|
| PubChem CID | 174278087 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-N'-methyl-2-nitro-1-N'-pyridin-3-ylethene-1,1-diamine |
| SMILES | CN(C(N)=C[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C8H10N4O2/c1-11(8(9)6-12(13)14)7-3-2-4-10-5-7/h2-6H,9H2,1H3 |
| InChIKey | NWEXTZALSRXSLY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|