C26H35N10O4+ — CID 158466540
(Z)-dimethylamino-[methyl(pyridin-3-ylmethyl)amino]-(nitromethylidene)azanium;1-N,1-N'-dimethyl-2-nitro-1-N,1-N'-bis(pyridin-3-ylmethyl)ethene-1,1-diamine (PubChem CID 158466540) has the molecular formula C26H35N10O4+ and a molecular weight of 551.63 g/mol. Its IUPAC name is (Z)-dimethylamino-[methyl(pyridin-3-ylmethyl)amino]-(nitromethylidene)azanium;1-N,1-N'-dimethyl-2-nitro-1-N,1-N'-bis(pyridin-3-ylmethyl)ethene-1,1-diamine.
| Compound Name | (Z)-dimethylamino-[methyl(pyridin-3-ylmethyl)amino]-(nitromethylidene)azanium;1-N,1-N'-dimethyl-2-nitro-1-N,1-N'-bis(pyridin-3-ylmethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 158466540 |
| Molecular Formula | C26H35N10O4+ |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | (Z)-dimethylamino-[methyl(pyridin-3-ylmethyl)amino]-(nitromethylidene)azanium;1-N,1-N'-dimethyl-2-nitro-1-N,1-N'-bis(pyridin-3-ylmethyl)ethene-1,1-diamine |
| SMILES | CN(C)/[N+](=C/[N+](=O)[O-])N(C)Cc1cccnc1.CN(Cc1cccnc1)C(=C[N+](=O)[O-])N(C)Cc1cccnc1 |
| InChI | InChI=1S/C16H19N5O2.C10H16N5O2/c1-19(11-14-5-3-7-17-9-14)16(13-21(22)23)20(2)12-15-6-4-8-18-10-15;1-12(2)14(9-15(16)17)13(3)8-10-5-4-6-11-7-10/h3-10,13H,11-12H2,1-2H3;4-7,9H,8H2,1-3H3/q;+1/b;14-9- |
| InChIKey | HSBCBMRBGGVSAA-FUFZTOQCSA-N |
| XLogP | 2.34 |
| TPSA | 140.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|