C10H16N4O2 — CID 70383096
1,1-dimethyl-2-(pyridin-3-ylmethyl)hydrazine;1-nitroethene (PubChem CID 70383096) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1,1-dimethyl-2-(pyridin-3-ylmethyl)hydrazine;1-nitroethene.
| Compound Name | 1,1-dimethyl-2-(pyridin-3-ylmethyl)hydrazine;1-nitroethene |
|---|---|
| PubChem CID | 70383096 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1,1-dimethyl-2-(pyridin-3-ylmethyl)hydrazine;1-nitroethene |
| SMILES | C=C[N+](=O)[O-].CN(C)NCc1cccnc1 |
| InChI | InChI=1S/C8H13N3.C2H3NO2/c1-11(2)10-7-8-4-3-5-9-6-8;1-2-3(4)5/h3-6,10H,7H2,1-2H3;2H,1H2 |
| InChIKey | TYBSYOAQLUZZEY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|