C12H20N4O2Si — CID 70157675
2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(trimethylsilylmethyl)ethene-1,1-diamine (PubChem CID 70157675) has the molecular formula C12H20N4O2Si and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(trimethylsilylmethyl)ethene-1,1-diamine.
| Compound Name | 2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(trimethylsilylmethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 70157675 |
| Molecular Formula | C12H20N4O2Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(trimethylsilylmethyl)ethene-1,1-diamine |
| SMILES | C[Si](C)(C)CNC(=C[N+](=O)[O-])NCc1cccnc1 |
| InChI | InChI=1S/C12H20N4O2Si/c1-19(2,3)10-15-12(9-16(17)18)14-8-11-5-4-6-13-7-11/h4-7,9,14-15H,8,10H2,1-3H3 |
| InChIKey | WZTYETUFXFGMAL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|