C10H12ClN3O5S — CID 174295631
3-[(6-chloro-3-pyridinyl)methyl-methylamino]-1-nitroprop-1-ene-2-sulfonic acid (PubChem CID 174295631) has the molecular formula C10H12ClN3O5S and a molecular weight of 321.74 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl-methylamino]-1-nitroprop-1-ene-2-sulfonic acid.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl-methylamino]-1-nitroprop-1-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 174295631 |
| Molecular Formula | C10H12ClN3O5S |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl-methylamino]-1-nitroprop-1-ene-2-sulfonic acid |
| SMILES | CN(CC(=C[N+](=O)[O-])S(=O)(=O)O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H12ClN3O5S/c1-13(5-8-2-3-10(11)12-4-8)6-9(7-14(15)16)20(17,18)19/h2-4,7H,5-6H2,1H3,(H,17,18,19) |
| InChIKey | QHNCGXSWQWJRTF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|