C7H12N2O3 — CID 87407886
2,2-dimethyl-N-[(Z)-2-nitroethenyl]propanamide (PubChem CID 87407886) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(Z)-2-nitroethenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(Z)-2-nitroethenyl]propanamide |
|---|---|
| PubChem CID | 87407886 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2,2-dimethyl-N-[(Z)-2-nitroethenyl]propanamide |
| SMILES | CC(C)(C)C(=O)N/C=C\[N+](=O)[O-] |
| InChI | InChI=1S/C7H12N2O3/c1-7(2,3)6(10)8-4-5-9(11)12/h4-5H,1-3H3,(H,8,10)/b5-4- |
| InChIKey | CREBIYITUBYYMQ-PLNGDYQASA-N |
| XLogP | 0.90 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|