C9H19NO2S — CID 162396789
N-tert-butylsulfinyl-2,2-dimethylpropanamide (PubChem CID 162396789) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is N-tert-butylsulfinyl-2,2-dimethylpropanamide.
| Compound Name | N-tert-butylsulfinyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 162396789 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-tert-butylsulfinyl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C9H19NO2S/c1-8(2,3)7(11)10-13(12)9(4,5)6/h1-6H3,(H,10,11) |
| InChIKey | MFZOHZOJUPCJRR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |