C8H20N6O3 — CID 176541851
2-carbamimidoyl-1-(3,3-dimethylbutyl)guanidine;nitric acid (PubChem CID 176541851) has the molecular formula C8H20N6O3 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-carbamimidoyl-1-(3,3-dimethylbutyl)guanidine;nitric acid.
| Compound Name | 2-carbamimidoyl-1-(3,3-dimethylbutyl)guanidine;nitric acid |
|---|---|
| PubChem CID | 176541851 |
| Molecular Formula | C8H20N6O3 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-carbamimidoyl-1-(3,3-dimethylbutyl)guanidine;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(N)/N=C(\N)NCCC(C)(C)C |
| InChI | InChI=1S/C8H19N5.HNO3/c1-8(2,3)4-5-12-7(11)13-6(9)10;2-1(3)4/h4-5H2,1-3H3,(H6,9,10,11,12,13);(H,2,3,4) |
| InChIKey | WSMIXAZLAJGLAF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|