C6H16N6O3 — CID 176523622
3-carbamimidoyl-2-ethyl-1,1-dimethylguanidine;nitric acid (PubChem CID 176523622) has the molecular formula C6H16N6O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-carbamimidoyl-2-ethyl-1,1-dimethylguanidine;nitric acid.
| Compound Name | 3-carbamimidoyl-2-ethyl-1,1-dimethylguanidine;nitric acid |
|---|---|
| PubChem CID | 176523622 |
| Molecular Formula | C6H16N6O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-carbamimidoyl-2-ethyl-1,1-dimethylguanidine;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N/C(=N/CC)N(C)C |
| InChI | InChI=1S/C6H15N5.HNO3/c1-4-9-6(11(2)3)10-5(7)8;2-1(3)4/h4H2,1-3H3,(H4,7,8,9,10);(H,2,3,4) |
| InChIKey | XPRBWDJMEGALDG-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|