C8H21N7O3 — CID 176530052
1-[6-(diaminomethylideneamino)hexyl]guanidine;nitric acid (PubChem CID 176530052) has the molecular formula C8H21N7O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[6-(diaminomethylideneamino)hexyl]guanidine;nitric acid.
| Compound Name | 1-[6-(diaminomethylideneamino)hexyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 176530052 |
| Molecular Formula | C8H21N7O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[6-(diaminomethylideneamino)hexyl]guanidine;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)NCCCCCCN=C(N)N |
| InChI | InChI=1S/C8H20N6.HNO3/c9-7(10)13-5-3-1-2-4-6-14-8(11)12;2-1(3)4/h1-6H2,(H4,9,10,13)(H4,11,12,14);(H,2,3,4) |
| InChIKey | VNYLKBNKTVRZIC-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|