About CID 176532250
CID 176532250 (PubChem CID 176532250) has the molecular formula C6H16N6O4S
and a molecular weight of 268.30 g/mol.
Molecular Properties
| Compound Name | CID 176532250 |
| PubChem CID | 176532250 |
| Molecular Formula | C6H16N6O4S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | — |
| SMILES | C(CCN=C(N)N)CNC(=N)N.[O]OS(=O)[O] |
| InChI | InChI=1S/C6H16N6.O4S/c7-5(8)11-3-1-2-4-12-6(9)10;1-4-5(2)3/h1-4H2,(H4,7,8,11)(H4,9,10,12); |
| InChIKey | ARAPXGOXPJWFGZ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 174.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 193 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 176532250 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176532250?
The IUPAC name of CID 176532250 (CID 176532250) is not available.
What is the SMILES notation for CID 176532250?
The canonical SMILES for CID 176532250 is C(CCN=C(N)N)CNC(=N)N.[O]OS(=O)[O].
What is the InChIKey of CID 176532250?
The InChIKey is ARAPXGOXPJWFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N6.O4S/c7-5(8)11-3-1-2-4-12-6(9)10;1-4-5(2)3/h1-4H2,(H4,7,8,11)(H4,9,10,12);.
What are the key properties of CID 176532250?
CID 176532250 has a molecular weight of 268.30 g/mol, XLogP of not available, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176532250 is sourced from PubChem (CID 176532250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).