C6H16N6O4S — CID 176532250
CID 176532250 (PubChem CID 176532250) has the molecular formula C6H16N6O4S and a molecular weight of 268.30 g/mol.
| Compound Name | CID 176532250 |
|---|---|
| PubChem CID | 176532250 |
| Molecular Formula | C6H16N6O4S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\N)NCCCCN=C(N)N.[O]OS([O])=O |
| InChI | InChI=1S/C6H16N6.O4S/c7-5(8)11-3-1-2-4-12-6(9)10;1-4-5(2)3/h1-4H2,(H4,7,8,11)(H4,9,10,12); |
| InChIKey | ARAPXGOXPJWFGZ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 192.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|