C8H20N6S4 — CID 176524133
1-[3-[3-(diaminomethylideneamino)propyltetrasulfanyl]propyl]guanidine (PubChem CID 176524133) has the molecular formula C8H20N6S4 and a molecular weight of 328.56 g/mol. Its IUPAC name is 1-[3-[3-(diaminomethylideneamino)propyltetrasulfanyl]propyl]guanidine.
| Compound Name | 1-[3-[3-(diaminomethylideneamino)propyltetrasulfanyl]propyl]guanidine |
|---|---|
| PubChem CID | 176524133 |
| Molecular Formula | C8H20N6S4 |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-[3-[3-(diaminomethylideneamino)propyltetrasulfanyl]propyl]guanidine |
| SMILES | [H]/N=C(\N)NCCCSSSSCCCN=C(N)N |
| InChI | InChI=1S/C8H20N6S4/c9-7(10)13-3-1-5-15-17-18-16-6-2-4-14-8(11)12/h1-6H2,(H4,9,10,13)(H4,11,12,14) |
| InChIKey | JOMSVRDQLCRFRZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|