C18H40N6O — CID 176522885
1-[8-[8-(diaminomethylideneamino)octoxy]octyl]guanidine (PubChem CID 176522885) has the molecular formula C18H40N6O and a molecular weight of 356.56 g/mol. Its IUPAC name is 1-[8-[8-(diaminomethylideneamino)octoxy]octyl]guanidine.
| Compound Name | 1-[8-[8-(diaminomethylideneamino)octoxy]octyl]guanidine |
|---|---|
| PubChem CID | 176522885 |
| Molecular Formula | C18H40N6O |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 1-[8-[8-(diaminomethylideneamino)octoxy]octyl]guanidine |
| SMILES | [H]/N=C(\N)NCCCCCCCCOCCCCCCCCN=C(N)N |
| InChI | InChI=1S/C18H40N6O/c19-17(20)23-13-9-5-1-3-7-11-15-25-16-12-8-4-2-6-10-14-24-18(21)22/h1-16H2,(H4,19,20,23)(H4,21,22,24) |
| InChIKey | CNCCKZXBYLXEIA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|