C14H36Cl4N6 — CID 176518301
1-[12-(diaminomethylideneamino)dodecyl]guanidine;tetrahydrochloride (PubChem CID 176518301) has the molecular formula C14H36Cl4N6 and a molecular weight of 430.30 g/mol. Its IUPAC name is 1-[12-(diaminomethylideneamino)dodecyl]guanidine;tetrahydrochloride.
| Compound Name | 1-[12-(diaminomethylideneamino)dodecyl]guanidine;tetrahydrochloride |
|---|---|
| PubChem CID | 176518301 |
| Molecular Formula | C14H36Cl4N6 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[12-(diaminomethylideneamino)dodecyl]guanidine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.[H]/N=C(\N)NCCCCCCCCCCCCN=C(N)N |
| InChI | InChI=1S/C14H32N6.4ClH/c15-13(16)19-11-9-7-5-3-1-2-4-6-8-10-12-20-14(17)18;;;;/h1-12H2,(H4,15,16,19)(H4,17,18,20);4*1H |
| InChIKey | PPEUFZOGUIYYGI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|