C11H26N6 — CID 176533990
1-(9-carbamimidamidononyl)guanidine (PubChem CID 176533990) has the molecular formula C11H26N6 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-(9-carbamimidamidononyl)guanidine.
| Compound Name | 1-(9-carbamimidamidononyl)guanidine |
|---|---|
| PubChem CID | 176533990 |
| Molecular Formula | C11H26N6 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-(9-carbamimidamidononyl)guanidine |
| SMILES | [H]/N=C(\N)NCCCCCCCCCN/C(N)=N/[H] |
| InChI | InChI=1S/C11H26N6/c12-10(13)16-8-6-4-2-1-3-5-7-9-17-11(14)15/h1-9H2,(H4,12,13,16)(H4,14,15,17) |
| InChIKey | NEMPOWLBSPRZFQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|