C7H17N7 — CID 176528848
1-[3-[(1-amino-4,5-dihydroimidazol-2-yl)amino]propyl]guanidine (PubChem CID 176528848) has the molecular formula C7H17N7 and a molecular weight of 199.26 g/mol. Its IUPAC name is 1-[3-[(1-amino-4,5-dihydroimidazol-2-yl)amino]propyl]guanidine.
| Compound Name | 1-[3-[(1-amino-4,5-dihydroimidazol-2-yl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 176528848 |
| Molecular Formula | C7H17N7 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | 1-[3-[(1-amino-4,5-dihydroimidazol-2-yl)amino]propyl]guanidine |
| SMILES | [H]/N=C(\N)NCCCNC1=NCCN1N |
| InChI | InChI=1S/C7H17N7/c8-6(9)11-2-1-3-12-7-13-4-5-14(7)10/h1-5,10H2,(H,12,13)(H4,8,9,11) |
| InChIKey | FDNUAMSGRORQFV-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|