C42H46N14O2+2 — CID 136807979
4,7-bis(3-carbamimidamidopropylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-3-yl)-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 136807979) has the molecular formula C42H46N14O2+2 and a molecular weight of 778.93 g/mol. Its IUPAC name is 4,7-bis(3-carbamimidamidopropylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-3-yl)-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 4,7-bis(3-carbamimidamidopropylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-3-yl)-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 136807979 |
| Molecular Formula | C42H46N14O2+2 |
| Molecular Weight | 778.93 g/mol |
| Exact Mass | 778.39 |
| IUPAC Name | 4,7-bis(3-carbamimidamidopropylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-3-yl)-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | [H]/N=C(\N)NCCCNc1cc(C(=O)Nc2cc3ccccc3[n+](C)c2)nc2c1ccc1c(NCCCN/C(N)=N/[H])cc(C(=O)Nc3cc4ccccc4[n+](C)c3)nc12 |
| InChI | InChI=1S/C42H44N14O2/c1-55-23-27(19-25-9-3-5-11-35(25)55)51-39(57)33-21-31(47-15-7-17-49-41(43)44)29-13-14-30-32(48-16-8-18-50-42(45)46)22-34(54-38(30)37(29)53-33)40(58)52-28-20-26-10-4-6-12-36(26)56(2)24-28/h3-6,9-14,19-24H,7-8,15-18H2,1-2H3,(H10-2,43,44,45,46,47,48,49,50,51,52,53,54,57,58)/p+2 |
| InChIKey | SODAXSSUOZANFT-UHFFFAOYSA-P |
| XLogP | 3.81 |
| TPSA | 239.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.93 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|