C42H44N8O2+2 — CID 142473283
4,7-bis(butylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-6-yl)-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 142473283) has the molecular formula C42H44N8O2+2 and a molecular weight of 692.87 g/mol. Its IUPAC name is 4,7-bis(butylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-6-yl)-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 4,7-bis(butylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-6-yl)-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 142473283 |
| Molecular Formula | C42H44N8O2+2 |
| Molecular Weight | 692.87 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | 4,7-bis(butylamino)-2-N,9-N-bis(1-methylquinolin-1-ium-6-yl)-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | CCCCNc1cc(C(=O)Nc2ccc3c(ccc[n+]3C)c2)nc2c1ccc1c(NCCCC)cc(C(=O)Nc3ccc4c(ccc[n+]4C)c3)nc12 |
| InChI | InChI=1S/C42H42N8O2/c1-5-7-19-43-33-25-35(41(51)45-29-13-17-37-27(23-29)11-9-21-49(37)3)47-39-31(33)15-16-32-34(44-20-8-6-2)26-36(48-40(32)39)42(52)46-30-14-18-38-28(24-30)12-10-22-50(38)4/h9-18,21-26H,5-8,19-20H2,1-4H3,(H2-2,43,44,45,46,47,48,51,52)/p+2 |
| InChIKey | CKOSYGBDMFQZIQ-UHFFFAOYSA-P |
| XLogP | 7.67 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.87 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|