C34H27BrN6O2+2 — CID 142473301
[4-[[5-bromo-9-[(1-methylquinolin-1-ium-6-yl)carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]-2-ethenylphenyl]-methyl-methylideneazanium (PubChem CID 142473301) has the molecular formula C34H27BrN6O2+2 and a molecular weight of 631.53 g/mol. Its IUPAC name is [4-[[5-bromo-9-[(1-methylquinolin-1-ium-6-yl)carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]-2-ethenylphenyl]-methyl-methylideneazanium.
| Compound Name | [4-[[5-bromo-9-[(1-methylquinolin-1-ium-6-yl)carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]-2-ethenylphenyl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 142473301 |
| Molecular Formula | C34H27BrN6O2+2 |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | [4-[[5-bromo-9-[(1-methylquinolin-1-ium-6-yl)carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]-2-ethenylphenyl]-methyl-methylideneazanium |
| SMILES | C=Cc1cc(NC(=O)c2ccc3c(Br)cc4ccc(C(=O)Nc5ccc6c(ccc[n+]6C)c5)nc4c3n2)ccc1[N+](=C)C |
| InChI | InChI=1S/C34H25BrN6O2/c1-5-20-17-23(9-14-29(20)40(2)3)36-34(43)28-13-11-25-26(35)19-22-8-12-27(38-31(22)32(25)39-28)33(42)37-24-10-15-30-21(18-24)7-6-16-41(30)4/h5-19H,1-2H2,3-4H3/p+2 |
| InChIKey | HWAZBZGNHDRWGQ-UHFFFAOYSA-P |
| XLogP | 6.65 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|