C32H21ClN6O2 — CID 142473302
9-N-[5,6-bis(ethenyl)-3-pyridinyl]-4-chloro-2-N-quinolin-3-yl-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 142473302) has the molecular formula C32H21ClN6O2 and a molecular weight of 557.01 g/mol. Its IUPAC name is 9-N-[5,6-bis(ethenyl)-3-pyridinyl]-4-chloro-2-N-quinolin-3-yl-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 9-N-[5,6-bis(ethenyl)-3-pyridinyl]-4-chloro-2-N-quinolin-3-yl-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 142473302 |
| Molecular Formula | C32H21ClN6O2 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 9-N-[5,6-bis(ethenyl)-3-pyridinyl]-4-chloro-2-N-quinolin-3-yl-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | C=Cc1cc(NC(=O)c2ccc3ccc4c(Cl)cc(C(=O)Nc5cnc6ccccc6c5)nc4c3n2)cnc1C=C |
| InChI | InChI=1S/C32H21ClN6O2/c1-3-18-13-21(16-34-25(18)4-2)36-31(40)27-12-10-19-9-11-23-24(33)15-28(39-30(23)29(19)38-27)32(41)37-22-14-20-7-5-6-8-26(20)35-17-22/h3-17H,1-2H2,(H,36,40)(H,37,41) |
| InChIKey | MBPSJMIDKMAICX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|