C17H20F2N4O — CID 112846806
N-(3,4-difluorophenyl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide (PubChem CID 112846806) has the molecular formula C17H20F2N4O and a molecular weight of 334.37 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112846806 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCCNc1cc(C(=O)Nc2ccc(F)c(F)c2)nc(C)n1 |
| InChI | InChI=1S/C17H20F2N4O/c1-3-4-5-8-20-16-10-15(21-11(2)22-16)17(24)23-12-6-7-13(18)14(19)9-12/h6-7,9-10H,3-5,8H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | LNBMDYKYYLJQID-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|