C19H24N4O3 — CID 112846783
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide (PubChem CID 112846783) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112846783 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-6-(pentylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCCNc1cc(C(=O)Nc2ccc3c(c2)OCCO3)nc(C)n1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-4-5-8-20-18-12-15(21-13(2)22-18)19(24)23-14-6-7-16-17(11-14)26-10-9-25-16/h6-7,11-12H,3-5,8-10H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | MUAVWTAJPGBFBB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|