C16H20N4O — CID 109320503
2-(butylamino)-6-methyl-N-phenylpyrimidine-4-carboxamide (PubChem CID 109320503) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(butylamino)-6-methyl-N-phenylpyrimidine-4-carboxamide.
| Compound Name | 2-(butylamino)-6-methyl-N-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320503 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(butylamino)-6-methyl-N-phenylpyrimidine-4-carboxamide |
| SMILES | CCCCNc1nc(C)cc(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N4O/c1-3-4-10-17-16-18-12(2)11-14(20-16)15(21)19-13-8-6-5-7-9-13/h5-9,11H,3-4,10H2,1-2H3,(H,19,21)(H,17,18,20) |
| InChIKey | PAADQQHAXCGKKN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|