C17H19F3N4O — CID 109320553
2-(butylamino)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109320553) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-(butylamino)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 2-(butylamino)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320553 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-(butylamino)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | CCCCNc1nc(C)cc(C(=O)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C17H19F3N4O/c1-3-4-9-21-16-22-11(2)10-14(24-16)15(25)23-13-8-6-5-7-12(13)17(18,19)20/h5-8,10H,3-4,9H2,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | IRZVPZFGHDJIEM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|