C18H23BrN4O — CID 109333387
N-(2-bromo-4-methylphenyl)-6-methyl-2-(pentylamino)pyrimidine-4-carboxamide (PubChem CID 109333387) has the molecular formula C18H23BrN4O and a molecular weight of 391.31 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-6-methyl-2-(pentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-6-methyl-2-(pentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109333387 |
| Molecular Formula | C18H23BrN4O |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-6-methyl-2-(pentylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCCNc1nc(C)cc(C(=O)Nc2ccc(C)cc2Br)n1 |
| InChI | InChI=1S/C18H23BrN4O/c1-4-5-6-9-20-18-21-13(3)11-16(23-18)17(24)22-15-8-7-12(2)10-14(15)19/h7-8,10-11H,4-6,9H2,1-3H3,(H,22,24)(H,20,21,23) |
| InChIKey | MJRHPUBPUMIXDS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|