C16H19BrN4O — CID 109318989
N-(3-bromo-4-methylphenyl)-6-methyl-2-(propylamino)pyrimidine-4-carboxamide (PubChem CID 109318989) has the molecular formula C16H19BrN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-6-methyl-2-(propylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-6-methyl-2-(propylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318989 |
| Molecular Formula | C16H19BrN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-6-methyl-2-(propylamino)pyrimidine-4-carboxamide |
| SMILES | CCCNc1nc(C)cc(C(=O)Nc2ccc(C)c(Br)c2)n1 |
| InChI | InChI=1S/C16H19BrN4O/c1-4-7-18-16-19-11(3)8-14(21-16)15(22)20-12-6-5-10(2)13(17)9-12/h5-6,8-9H,4,7H2,1-3H3,(H,20,22)(H,18,19,21) |
| InChIKey | PZTOZTXACMXQKW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |