C16H17BrN4O — CID 109320194
N-(2-bromo-4-methylphenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide (PubChem CID 109320194) has the molecular formula C16H17BrN4O and a molecular weight of 361.24 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320194 |
| Molecular Formula | C16H17BrN4O |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNc1nc(C)cc(C(=O)Nc2ccc(C)cc2Br)n1 |
| InChI | InChI=1S/C16H17BrN4O/c1-4-7-18-16-19-11(3)9-14(21-16)15(22)20-13-6-5-10(2)8-12(13)17/h4-6,8-9H,1,7H2,2-3H3,(H,20,22)(H,18,19,21) |
| InChIKey | DJGOVDUEYDVCKX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|