C15H15BrN4O — CID 109320193
N-(3-bromophenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide (PubChem CID 109320193) has the molecular formula C15H15BrN4O and a molecular weight of 347.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-bromophenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320193 |
| Molecular Formula | C15H15BrN4O |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-(3-bromophenyl)-6-methyl-2-(prop-2-enylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNc1nc(C)cc(C(=O)Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H15BrN4O/c1-3-7-17-15-18-10(2)8-13(20-15)14(21)19-12-6-4-5-11(16)9-12/h3-6,8-9H,1,7H2,2H3,(H,19,21)(H,17,18,20) |
| InChIKey | WROYLZALJNFIDY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|