C13H27N3 — CID 70596750
N,1-dipentyl-4,5-dihydroimidazol-2-amine (PubChem CID 70596750) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is N,1-dipentyl-4,5-dihydroimidazol-2-amine.
| Compound Name | N,1-dipentyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 70596750 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | N,1-dipentyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCCCNC1=NCCN1CCCCC |
| InChI | InChI=1S/C13H27N3/c1-3-5-7-9-14-13-15-10-12-16(13)11-8-6-4-2/h3-12H2,1-2H3,(H,14,15) |
| InChIKey | XUMLLNVCWKGZOT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|