C19H37ClN2 — CID 139656970
2-chloro-1-hexadecyl-4,5-dihydroimidazole (PubChem CID 139656970) has the molecular formula C19H37ClN2 and a molecular weight of 328.97 g/mol. Its IUPAC name is 2-chloro-1-hexadecyl-4,5-dihydroimidazole.
| Compound Name | 2-chloro-1-hexadecyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 139656970 |
| Molecular Formula | C19H37ClN2 |
| Molecular Weight | 328.97 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 2-chloro-1-hexadecyl-4,5-dihydroimidazole |
| SMILES | CCCCCCCCCCCCCCCCN1CCN=C1Cl |
| InChI | InChI=1S/C19H37ClN2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-22-18-16-21-19(22)20/h2-18H2,1H3 |
| InChIKey | WNYQZMUFBFOOPS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|