C15H32ClN3O — CID 161184867
1-dodecyl-4,5-dihydroimidazol-2-amine;hypochlorous acid (PubChem CID 161184867) has the molecular formula C15H32ClN3O and a molecular weight of 305.89 g/mol. Its IUPAC name is 1-dodecyl-4,5-dihydroimidazol-2-amine;hypochlorous acid.
| Compound Name | 1-dodecyl-4,5-dihydroimidazol-2-amine;hypochlorous acid |
|---|---|
| PubChem CID | 161184867 |
| Molecular Formula | C15H32ClN3O |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-dodecyl-4,5-dihydroimidazol-2-amine;hypochlorous acid |
| SMILES | CCCCCCCCCCCCN1CCN=C1N.OCl |
| InChI | InChI=1S/C15H31N3.ClHO/c1-2-3-4-5-6-7-8-9-10-11-13-18-14-12-17-15(18)16;1-2/h2-14H2,1H3,(H2,16,17);2H |
| InChIKey | USYMNCWXHCIFNC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|