C11H22N2 — CID 15395015
1-heptyl-2-methyl-4,5-dihydroimidazole (PubChem CID 15395015) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-heptyl-2-methyl-4,5-dihydroimidazole.
| Compound Name | 1-heptyl-2-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 15395015 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-heptyl-2-methyl-4,5-dihydroimidazole |
| SMILES | CCCCCCCN1CCN=C1C |
| InChI | InChI=1S/C11H22N2/c1-3-4-5-6-7-9-13-10-8-12-11(13)2/h3-10H2,1-2H3 |
| InChIKey | UTTNQOLBUCXWDM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|