C6H12FN3S — CID 138502696
2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]ethyl thiohypofluorite (PubChem CID 138502696) has the molecular formula C6H12FN3S and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]ethyl thiohypofluorite.
| Compound Name | 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]ethyl thiohypofluorite |
|---|---|
| PubChem CID | 138502696 |
| Molecular Formula | C6H12FN3S |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]ethyl thiohypofluorite |
| SMILES | CN1CCN=C1NCCSF |
| InChI | InChI=1S/C6H12FN3S/c1-10-4-2-8-6(10)9-3-5-11-7/h2-5H2,1H3,(H,8,9) |
| InChIKey | CPFZWCBTDHBQGY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|