About 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide
3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide (PubChem CID 120972354) has the molecular formula C11H24IN3O
and a molecular weight of 341.24 g/mol. Its IUPAC name is 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide.
Molecular Properties
| Compound Name | 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide |
| PubChem CID | 120972354 |
| Molecular Formula | C11H24IN3O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide |
| SMILES | CCC(O)(CC)CCNC1=NCCN1C.I |
| InChI | InChI=1S/C11H23N3O.HI/c1-4-11(15,5-2)6-7-12-10-13-8-9-14(10)3;/h15H,4-9H2,1-3H3,(H,12,13);1H |
| InChIKey | XCRGBFFUQMSIRB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide?
The IUPAC name of 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide (CID 120972354) is 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide.
What is the SMILES notation for 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide?
The canonical SMILES for 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide is CCC(O)(CC)CCNC1=NCCN1C.I.
What is the InChIKey of 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide?
The InChIKey is XCRGBFFUQMSIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O.HI/c1-4-11(15,5-2)6-7-12-10-13-8-9-14(10)3;/h15H,4-9H2,1-3H3,(H,12,13);1H.
What are the key properties of 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide?
3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide has a molecular weight of 341.24 g/mol, XLogP of 1.44, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]pentan-3-ol;hydroiodide is sourced from PubChem (CID 120972354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).