C12H24IN3 — CID 120971656
N-[(1-ethylcyclopentyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120971656) has the molecular formula C12H24IN3 and a molecular weight of 337.25 g/mol. Its IUPAC name is N-[(1-ethylcyclopentyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[(1-ethylcyclopentyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120971656 |
| Molecular Formula | C12H24IN3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[(1-ethylcyclopentyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CCC1(CNC2=NCCN2C)CCCC1.I |
| InChI | InChI=1S/C12H23N3.HI/c1-3-12(6-4-5-7-12)10-14-11-13-8-9-15(11)2;/h3-10H2,1-2H3,(H,13,14);1H |
| InChIKey | LORMWJGHDXUCJY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|