C17H26IN3 — CID 120970860
1-methyl-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120970860) has the molecular formula C17H26IN3 and a molecular weight of 399.32 g/mol. Its IUPAC name is 1-methyl-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | 1-methyl-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120970860 |
| Molecular Formula | C17H26IN3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-methyl-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | Cc1cccc(C2(CNC3=NCCN3C)CCCC2)c1.I |
| InChI | InChI=1S/C17H25N3.HI/c1-14-6-5-7-15(12-14)17(8-3-4-9-17)13-19-16-18-10-11-20(16)2;/h5-7,12H,3-4,8-11,13H2,1-2H3,(H,18,19);1H |
| InChIKey | LARSGJWEUVJXRJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|