C17H25NO3S — CID 95322111
(2R)-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-2-methylsulfonylpropanamide (PubChem CID 95322111) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R)-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 95322111 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2R)-N-[[1-(3-methylphenyl)cyclopentyl]methyl]-2-methylsulfonylpropanamide |
| SMILES | Cc1cccc(C2(CNC(=O)[C@@H](C)S(C)(=O)=O)CCCC2)c1 |
| InChI | InChI=1S/C17H25NO3S/c1-13-7-6-8-15(11-13)17(9-4-5-10-17)12-18-16(19)14(2)22(3,20)21/h6-8,11,14H,4-5,9-10,12H2,1-3H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | LZMCNCUZANLEJU-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |