C20H30N2O3 — CID 110936718
1-[(4-hydroxyoxan-4-yl)methyl]-3-[[1-(3-methylphenyl)cyclopentyl]methyl]urea (PubChem CID 110936718) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(4-hydroxyoxan-4-yl)methyl]-3-[[1-(3-methylphenyl)cyclopentyl]methyl]urea.
| Compound Name | 1-[(4-hydroxyoxan-4-yl)methyl]-3-[[1-(3-methylphenyl)cyclopentyl]methyl]urea |
|---|---|
| PubChem CID | 110936718 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[(4-hydroxyoxan-4-yl)methyl]-3-[[1-(3-methylphenyl)cyclopentyl]methyl]urea |
| SMILES | Cc1cccc(C2(CNC(=O)NCC3(O)CCOCC3)CCCC2)c1 |
| InChI | InChI=1S/C20H30N2O3/c1-16-5-4-6-17(13-16)19(7-2-3-8-19)14-21-18(23)22-15-20(24)9-11-25-12-10-20/h4-6,13,24H,2-3,7-12,14-15H2,1H3,(H2,21,22,23) |
| InChIKey | IJENECWGNNMLHZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |