C27H36N2O4S — CID 55802503
N-[[1-(3-methylphenyl)cyclohexyl]methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 55802503) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is N-[[1-(3-methylphenyl)cyclohexyl]methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[[1-(3-methylphenyl)cyclohexyl]methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55802503 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[[1-(3-methylphenyl)cyclohexyl]methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | Cc1cccc(C2(CNC(=O)CCc3ccc(S(=O)(=O)N4CCOCC4)cc3)CCCCC2)c1 |
| InChI | InChI=1S/C27H36N2O4S/c1-22-6-5-7-24(20-22)27(14-3-2-4-15-27)21-28-26(30)13-10-23-8-11-25(12-9-23)34(31,32)29-16-18-33-19-17-29/h5-9,11-12,20H,2-4,10,13-19,21H2,1H3,(H,28,30) |
| InChIKey | JAVQISPADCFXNL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |