C27H29NO2 — CID 100517750
N-[[4-(3-methylphenyl)oxan-4-yl]methyl]-2-(4-phenylphenyl)acetamide (PubChem CID 100517750) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is N-[[4-(3-methylphenyl)oxan-4-yl]methyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[[4-(3-methylphenyl)oxan-4-yl]methyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 100517750 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[[4-(3-methylphenyl)oxan-4-yl]methyl]-2-(4-phenylphenyl)acetamide |
| SMILES | Cc1cccc(C2(CNC(=O)Cc3ccc(-c4ccccc4)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C27H29NO2/c1-21-6-5-9-25(18-21)27(14-16-30-17-15-27)20-28-26(29)19-22-10-12-24(13-11-22)23-7-3-2-4-8-23/h2-13,18H,14-17,19-20H2,1H3,(H,28,29) |
| InChIKey | WRHIWPPDZDTKHG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |