C22H27NO2S — CID 95933084
2-[(3-methylphenyl)methylsulfanyl]-N-[(4-phenyloxan-4-yl)methyl]acetamide (PubChem CID 95933084) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylsulfanyl]-N-[(4-phenyloxan-4-yl)methyl]acetamide.
| Compound Name | 2-[(3-methylphenyl)methylsulfanyl]-N-[(4-phenyloxan-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 95933084 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[(3-methylphenyl)methylsulfanyl]-N-[(4-phenyloxan-4-yl)methyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)NCC2(c3ccccc3)CCOCC2)c1 |
| InChI | InChI=1S/C22H27NO2S/c1-18-6-5-7-19(14-18)15-26-16-21(24)23-17-22(10-12-25-13-11-22)20-8-3-2-4-9-20/h2-9,14H,10-13,15-17H2,1H3,(H,23,24) |
| InChIKey | NYTKZYXUMIXBFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |