C22H33N3O5S2 — CID 55658582
3-(4-morpholin-4-ylsulfonylphenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]propanamide (PubChem CID 55658582) has the molecular formula C22H33N3O5S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]propanamide.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 55658582 |
| Molecular Formula | C22H33N3O5S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C22H33N3O5S2/c26-21(23-17-22(7-16-31-18-22)24-8-12-29-13-9-24)6-3-19-1-4-20(5-2-19)32(27,28)25-10-14-30-15-11-25/h1-2,4-5H,3,6-18H2,(H,23,26) |
| InChIKey | SLXMMRGEJQUBIK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |