C24H29N3O2S2 — CID 55658366
N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenothiazin-10-ylpropanamide (PubChem CID 55658366) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 55658366 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenothiazin-10-ylpropanamide |
| SMILES | O=C(CCN1c2ccccc2Sc2ccccc21)NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C24H29N3O2S2/c28-23(25-17-24(10-16-30-18-24)26-12-14-29-15-13-26)9-11-27-19-5-1-3-7-21(19)31-22-8-4-2-6-20(22)27/h1-8H,9-18H2,(H,25,28) |
| InChIKey | UHQBXEMKOADVTM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|