C21H31N3O4S — CID 55842494
benzyl N-[4-[(3-morpholin-4-ylthiolan-3-yl)methylamino]-4-oxobutyl]carbamate (PubChem CID 55842494) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is benzyl N-[4-[(3-morpholin-4-ylthiolan-3-yl)methylamino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[(3-morpholin-4-ylthiolan-3-yl)methylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55842494 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | benzyl N-[4-[(3-morpholin-4-ylthiolan-3-yl)methylamino]-4-oxobutyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C21H31N3O4S/c25-19(7-4-9-22-20(26)28-15-18-5-2-1-3-6-18)23-16-21(8-14-29-17-21)24-10-12-27-13-11-24/h1-3,5-6H,4,7-17H2,(H,22,26)(H,23,25) |
| InChIKey | OTCCJTWIEQXVRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|