C27H28N4O3S — CID 37151951
N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-3-phenothiazin-10-ylpropanamide (PubChem CID 37151951) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 37151951 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-3-phenothiazin-10-ylpropanamide |
| SMILES | O=C(CCN1c2ccccc2Sc2ccccc21)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c32-26(13-14-31-22-5-1-3-7-24(22)35-25-8-4-2-6-23(25)31)28-20-9-11-21(12-10-20)29-27(33)19-30-15-17-34-18-16-30/h1-12H,13-19H2,(H,28,32)(H,29,33) |
| InChIKey | SKPBGEUUQHVIFB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|