C20H27N5O3 — CID 51126229
4-(2-methylimidazol-1-yl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide (PubChem CID 51126229) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(2-methylimidazol-1-yl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide.
| Compound Name | 4-(2-methylimidazol-1-yl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 51126229 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide |
| SMILES | Cc1nccn1CCCC(=O)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H27N5O3/c1-16-21-8-10-25(16)9-2-3-19(26)22-17-4-6-18(7-5-17)23-20(27)15-24-11-13-28-14-12-24/h4-8,10H,2-3,9,11-15H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | SGOVXNQUKRAYLD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |