C18H26N4O — CID 56785420
4-(2-methylimidazol-1-yl)-N-[3-[methyl(propan-2-yl)amino]phenyl]butanamide (PubChem CID 56785420) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-(2-methylimidazol-1-yl)-N-[3-[methyl(propan-2-yl)amino]phenyl]butanamide.
| Compound Name | 4-(2-methylimidazol-1-yl)-N-[3-[methyl(propan-2-yl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 56785420 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-N-[3-[methyl(propan-2-yl)amino]phenyl]butanamide |
| SMILES | Cc1nccn1CCCC(=O)Nc1cccc(N(C)C(C)C)c1 |
| InChI | InChI=1S/C18H26N4O/c1-14(2)21(4)17-8-5-7-16(13-17)20-18(23)9-6-11-22-12-10-19-15(22)3/h5,7-8,10,12-14H,6,9,11H2,1-4H3,(H,20,23) |
| InChIKey | XEPLWLPJLVUBJQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |