C23H28N4O4 — CID 46762249
N,N'-bis[3-[acetyl(methyl)amino]phenyl]pentanediamide (PubChem CID 46762249) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N,N'-bis[3-[acetyl(methyl)amino]phenyl]pentanediamide.
| Compound Name | N,N'-bis[3-[acetyl(methyl)amino]phenyl]pentanediamide |
|---|---|
| PubChem CID | 46762249 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N,N'-bis[3-[acetyl(methyl)amino]phenyl]pentanediamide |
| SMILES | CC(=O)N(C)c1cccc(NC(=O)CCCC(=O)Nc2cccc(N(C)C(C)=O)c2)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-16(28)26(3)20-10-5-8-18(14-20)24-22(30)12-7-13-23(31)25-19-9-6-11-21(15-19)27(4)17(2)29/h5-6,8-11,14-15H,7,12-13H2,1-4H3,(H,24,30)(H,25,31) |
| InChIKey | RIXVECLEDVNKOA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |